C7H12N3O12P3-4 — CID 59914489
[[[(2R,3R,5S)-2-(azidomethyl)-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 59914489) has the molecular formula C7H12N3O12P3-4 and a molecular weight of 423.10 g/mol. Its IUPAC name is [[[(2R,3R,5S)-2-(azidomethyl)-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2R,3R,5S)-2-(azidomethyl)-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 59914489 |
| Molecular Formula | C7H12N3O12P3-4 |
| Molecular Weight | 423.10 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | [[[(2R,3R,5S)-2-(azidomethyl)-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | C[C@H]1C[C@@H](O)[C@@](CN=[N+]=[N-])(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C7H16N3O12P3/c1-5-2-6(11)7(20-5,3-9-10-8)4-19-24(15,16)22-25(17,18)21-23(12,13)14/h5-6,11H,2-4H2,1H3,(H,15,16)(H,17,18)(H2,12,13,14)/p-4/t5-,6+,7+/m0/s1 |
| InChIKey | KCNMPOOGPIERAO-RRKCRQDMSA-J |
| XLogP | -1.98 |
| TPSA | 249.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.10 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|