C6H12NO11P3-4 — CID 59905576
[[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methylamino]-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate (PubChem CID 59905576) has the molecular formula C6H12NO11P3-4 and a molecular weight of 367.08 g/mol. Its IUPAC name is [[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methylamino]-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate.
| Compound Name | [[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methylamino]-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate |
|---|---|
| PubChem CID | 59905576 |
| Molecular Formula | C6H12NO11P3-4 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | [[(2R,5S)-3-hydroxy-5-methyloxolan-2-yl]methylamino]-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate |
| SMILES | C[C@H]1CC(O)[C@@H](CNP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C6H16NO11P3/c1-4-2-5(8)6(16-4)3-7-19(9,10)17-21(14,15)18-20(11,12)13/h4-6,8H,2-3H2,1H3,(H,14,15)(H2,7,9,10)(H2,11,12,13)/p-4/t4-,5?,6+/m0/s1 |
| InChIKey | FSZBJTAWBIBMIP-NOWQFEBASA-J |
| XLogP | -3.09 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|