C7H9CaO7P — CID 154720211
calcium [(2R,3S)-2-ethynyl-3,5-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 154720211) has the molecular formula C7H9CaO7P and a molecular weight of 276.19 g/mol. Its IUPAC name is calcium [(2R,3S)-2-ethynyl-3,5-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | calcium [(2R,3S)-2-ethynyl-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 154720211 |
| Molecular Formula | C7H9CaO7P |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | calcium [(2R,3S)-2-ethynyl-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | C#C[C@]1(COP(=O)([O-])[O-])OC(O)C[C@@H]1O.[Ca+2] |
| InChI | InChI=1S/C7H11O7P.Ca/c1-2-7(4-13-15(10,11)12)5(8)3-6(9)14-7;/h1,5-6,8-9H,3-4H2,(H2,10,11,12);/q;+2/p-2/t5-,6?,7+;/m0./s1 |
| InChIKey | JXUGYWIEHLMAEW-CAYNQFBISA-L |
| XLogP | -3.08 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|