C7H10O7P- — CID 164835779
[(4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate (PubChem CID 164835779) has the molecular formula C7H10O7P- and a molecular weight of 237.12 g/mol. Its IUPAC name is [(4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate.
| Compound Name | [(4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 164835779 |
| Molecular Formula | C7H10O7P- |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | [(4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hydrogen phosphate |
| SMILES | C#C[C@]1(CO)OC(OP(=O)([O-])O)C[C@@H]1O |
| InChI | InChI=1S/C7H11O7P/c1-2-7(4-8)5(9)3-6(13-7)14-15(10,11)12/h1,5-6,8-9H,3-4H2,(H2,10,11,12)/p-1/t5-,6?,7+/m0/s1 |
| InChIKey | XSAZWVLXPXTCKK-REJBHVJUSA-M |
| XLogP | -2.06 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|