C24H29ClN2O4 — CID 22965941
ethyl 4-(12-chloro-2-hydroxy-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)piperidine-1-carboxylate (PubChem CID 22965941) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is ethyl 4-(12-chloro-2-hydroxy-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(12-chloro-2-hydroxy-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22965941 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | ethyl 4-(12-chloro-2-hydroxy-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C2(O)c3ncccc3CCc3c(Cl)c(C)cc(OC)c32)CC1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-4-31-23(28)27-12-9-17(10-13-27)24(29)20-18(21(25)15(2)14-19(20)30-3)8-7-16-6-5-11-26-22(16)24/h5-6,11,14,17,29H,4,7-10,12-13H2,1-3H3 |
| InChIKey | NRAVBXOBWMVQBF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |