C30H24N2O2+2 — CID 22968668
17,17-dimethyl-24-phenyl-2,25-dioxa-10,24-diazoniahexacyclo[16.6.2.01,10.03,8.011,16.022,26]hexacosa-3,5,7,9,11,13,15,18,20,22(26),23-undecaene (PubChem CID 22968668) has the molecular formula C30H24N2O2+2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 17,17-dimethyl-24-phenyl-2,25-dioxa-10,24-diazoniahexacyclo[16.6.2.01,10.03,8.011,16.022,26]hexacosa-3,5,7,9,11,13,15,18,20,22(26),23-undecaene.
| Compound Name | 17,17-dimethyl-24-phenyl-2,25-dioxa-10,24-diazoniahexacyclo[16.6.2.01,10.03,8.011,16.022,26]hexacosa-3,5,7,9,11,13,15,18,20,22(26),23-undecaene |
|---|---|
| PubChem CID | 22968668 |
| Molecular Formula | C30H24N2O2+2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 17,17-dimethyl-24-phenyl-2,25-dioxa-10,24-diazoniahexacyclo[16.6.2.01,10.03,8.011,16.022,26]hexacosa-3,5,7,9,11,13,15,18,20,22(26),23-undecaene |
| SMILES | CC1(C)c2ccccc2[N+]2=Cc3ccccc3OC23Oc2c(cccc21)C=[N+]3c1ccccc1 |
| InChI | InChI=1S/C30H24N2O2/c1-29(2)24-15-7-8-17-26(24)32-19-21-11-6-9-18-27(21)33-30(32)31(23-13-4-3-5-14-23)20-22-12-10-16-25(29)28(22)34-30/h3-20H,1-2H3/q+2 |
| InChIKey | ILIVOYHPPCUGKF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|