C30H24N2O2+2 — CID 158292494
(1R)-10,10-dimethyl-16,20-diphenyl-2,17-dioxa-16,20-diazoniapentacyclo[9.5.3.11,9.03,8.014,18]icosa-3,5,7,9(20),11(19),12,14(18),15-octaene (PubChem CID 158292494) has the molecular formula C30H24N2O2+2 and a molecular weight of 444.53 g/mol. Its IUPAC name is (1R)-10,10-dimethyl-16,20-diphenyl-2,17-dioxa-16,20-diazoniapentacyclo[9.5.3.11,9.03,8.014,18]icosa-3,5,7,9(20),11(19),12,14(18),15-octaene.
| Compound Name | (1R)-10,10-dimethyl-16,20-diphenyl-2,17-dioxa-16,20-diazoniapentacyclo[9.5.3.11,9.03,8.014,18]icosa-3,5,7,9(20),11(19),12,14(18),15-octaene |
|---|---|
| PubChem CID | 158292494 |
| Molecular Formula | C30H24N2O2+2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (1R)-10,10-dimethyl-16,20-diphenyl-2,17-dioxa-16,20-diazoniapentacyclo[9.5.3.11,9.03,8.014,18]icosa-3,5,7,9(20),11(19),12,14(18),15-octaene |
| SMILES | CC1(C)C2=[N+](c3ccccc3)[C@]3(Oc4cc1ccc4C=[N+]3c1ccccc1)Oc1ccccc12 |
| InChI | InChI=1S/C30H24N2O2/c1-29(2)22-18-17-21-20-31(23-11-5-3-6-12-23)30(34-27(21)19-22)32(24-13-7-4-8-14-24)28(29)25-15-9-10-16-26(25)33-30/h3-20H,1-2H3/q+2/t30-/m0/s1 |
| InChIKey | SXLOMQJNYXBHFY-PMERELPUSA-N |
| XLogP | 5.97 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|