C31H26N2O2+2 — CID 23392788
9,16-diphenyl-2,23-dioxa-10,15-diazoniapentacyclo[13.8.0.01,10.03,8.017,22]tricosa-3,5,7,9,15,17,19,21-octaene (PubChem CID 23392788) has the molecular formula C31H26N2O2+2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 9,16-diphenyl-2,23-dioxa-10,15-diazoniapentacyclo[13.8.0.01,10.03,8.017,22]tricosa-3,5,7,9,15,17,19,21-octaene.
| Compound Name | 9,16-diphenyl-2,23-dioxa-10,15-diazoniapentacyclo[13.8.0.01,10.03,8.017,22]tricosa-3,5,7,9,15,17,19,21-octaene |
|---|---|
| PubChem CID | 23392788 |
| Molecular Formula | C31H26N2O2+2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 9,16-diphenyl-2,23-dioxa-10,15-diazoniapentacyclo[13.8.0.01,10.03,8.017,22]tricosa-3,5,7,9,15,17,19,21-octaene |
| SMILES | c1ccc(C2=[N+]3CCCC[N+]4=C(c5ccccc5)c5ccccc5OC34Oc3ccccc32)cc1 |
| InChI | InChI=1S/C31H26N2O2/c1-3-13-23(14-4-1)29-25-17-7-9-19-27(25)34-31-32(29)21-11-12-22-33(31)30(24-15-5-2-6-16-24)26-18-8-10-20-28(26)35-31/h1-10,13-20H,11-12,21-22H2/q+2 |
| InChIKey | QFXRUXUPVLSIKV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|