C12H18O3 — CID 22970222
4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 22970222) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | 4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 22970222 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC1CC2CC(=O)CC2C1C1OCCO1 |
| InChI | InChI=1S/C12H18O3/c1-7-4-8-5-9(13)6-10(8)11(7)12-14-2-3-15-12/h7-8,10-12H,2-6H2,1H3 |
| InChIKey | RVYLDZSCPNECTH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |