C20H23N5O2S3 — CID 22971438
3-(carbamothioylamino)-N-[5-[[5-(2,2-dimethylpropyl)-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 22971438) has the molecular formula C20H23N5O2S3 and a molecular weight of 461.64 g/mol. Its IUPAC name is 3-(carbamothioylamino)-N-[5-[[5-(2,2-dimethylpropyl)-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-(carbamothioylamino)-N-[5-[[5-(2,2-dimethylpropyl)-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 22971438 |
| Molecular Formula | C20H23N5O2S3 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 3-(carbamothioylamino)-N-[5-[[5-(2,2-dimethylpropyl)-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)(C)Cc1cnc(CSc2cnc(NC(=O)c3cccc(NC(N)=S)c3)s2)o1 |
| InChI | InChI=1S/C20H23N5O2S3/c1-20(2,3)8-14-9-22-15(27-14)11-29-16-10-23-19(30-16)25-17(26)12-5-4-6-13(7-12)24-18(21)28/h4-7,9-10H,8,11H2,1-3H3,(H3,21,24,28)(H,23,25,26) |
| InChIKey | GBGKRKCBXRVSAT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|