C24H30N4O5S2 — CID 25226546
N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-4-[6-(hydroxyamino)-6-oxohexoxy]benzamide (PubChem CID 25226546) has the molecular formula C24H30N4O5S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-4-[6-(hydroxyamino)-6-oxohexoxy]benzamide.
| Compound Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-4-[6-(hydroxyamino)-6-oxohexoxy]benzamide |
|---|---|
| PubChem CID | 25226546 |
| Molecular Formula | C24H30N4O5S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-4-[6-(hydroxyamino)-6-oxohexoxy]benzamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(=O)c3ccc(OCCCCCC(=O)NO)cc3)s2)o1 |
| InChI | InChI=1S/C24H30N4O5S2/c1-24(2,3)18-13-25-20(33-18)15-34-21-14-26-23(35-21)27-22(30)16-8-10-17(11-9-16)32-12-6-4-5-7-19(29)28-31/h8-11,13-14,31H,4-7,12,15H2,1-3H3,(H,28,29)(H,26,27,30) |
| InChIKey | FGTFEPLZPQFOAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|