C22H21NO2 — CID 22971799
2,5-bis[1-(4-methoxyphenyl)ethenyl]-1H-pyrrole (PubChem CID 22971799) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2,5-bis[1-(4-methoxyphenyl)ethenyl]-1H-pyrrole.
| Compound Name | 2,5-bis[1-(4-methoxyphenyl)ethenyl]-1H-pyrrole |
|---|---|
| PubChem CID | 22971799 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2,5-bis[1-(4-methoxyphenyl)ethenyl]-1H-pyrrole |
| SMILES | C=C(c1ccc(OC)cc1)c1ccc(C(=C)c2ccc(OC)cc2)[nH]1 |
| InChI | InChI=1S/C22H21NO2/c1-15(17-5-9-19(24-3)10-6-17)21-13-14-22(23-21)16(2)18-7-11-20(25-4)12-8-18/h5-14,23H,1-2H2,3-4H3 |
| InChIKey | GWJRTOREDVYQDI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |