C30H29N3O3 — CID 22978531
benzyl N-[[2-[2-[ethyl(pyridin-4-ylmethyl)carbamoyl]phenyl]phenyl]methyl]carbamate (PubChem CID 22978531) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is benzyl N-[[2-[2-[ethyl(pyridin-4-ylmethyl)carbamoyl]phenyl]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[2-[2-[ethyl(pyridin-4-ylmethyl)carbamoyl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22978531 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | benzyl N-[[2-[2-[ethyl(pyridin-4-ylmethyl)carbamoyl]phenyl]phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccncc1)C(=O)c1ccccc1-c1ccccc1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H29N3O3/c1-2-33(21-23-16-18-31-19-17-23)29(34)28-15-9-8-14-27(28)26-13-7-6-12-25(26)20-32-30(35)36-22-24-10-4-3-5-11-24/h3-19H,2,20-22H2,1H3,(H,32,35) |
| InChIKey | PCDNVNHKIFMLRZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |