C22H18ClNO4 — CID 23442970
2-[2-[[(2-chlorophenyl)methoxycarbonylamino]methyl]phenyl]benzoic acid (PubChem CID 23442970) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is 2-[2-[[(2-chlorophenyl)methoxycarbonylamino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[[(2-chlorophenyl)methoxycarbonylamino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 23442970 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[2-[[(2-chlorophenyl)methoxycarbonylamino]methyl]phenyl]benzoic acid |
| SMILES | O=C(NCc1ccccc1-c1ccccc1C(=O)O)OCc1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO4/c23-20-12-6-2-8-16(20)14-28-22(27)24-13-15-7-1-3-9-17(15)18-10-4-5-11-19(18)21(25)26/h1-12H,13-14H2,(H,24,27)(H,25,26) |
| InChIKey | MVMYXMDQUXKNEK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |