C39H27N3O7 — CID 22979039
benzyl 4-[[7-(4-nitro-3-phenylmethoxyphenoxy)-1,10-phenanthrolin-4-yl]oxy]benzoate (PubChem CID 22979039) has the molecular formula C39H27N3O7 and a molecular weight of 649.66 g/mol. Its IUPAC name is benzyl 4-[[7-(4-nitro-3-phenylmethoxyphenoxy)-1,10-phenanthrolin-4-yl]oxy]benzoate.
| Compound Name | benzyl 4-[[7-(4-nitro-3-phenylmethoxyphenoxy)-1,10-phenanthrolin-4-yl]oxy]benzoate |
|---|---|
| PubChem CID | 22979039 |
| Molecular Formula | C39H27N3O7 |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | benzyl 4-[[7-(4-nitro-3-phenylmethoxyphenoxy)-1,10-phenanthrolin-4-yl]oxy]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(Oc2ccnc3c2ccc2c(Oc4ccc([N+](=O)[O-])c(OCc5ccccc5)c4)ccnc23)cc1 |
| InChI | InChI=1S/C39H27N3O7/c43-39(47-25-27-9-5-2-6-10-27)28-11-13-29(14-12-28)48-34-19-21-40-37-31(34)16-17-32-35(20-22-41-38(32)37)49-30-15-18-33(42(44)45)36(23-30)46-24-26-7-3-1-4-8-26/h1-23H,24-25H2 |
| InChIKey | MNZCFOYZSFXTFO-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 122.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|