C36H21F6N3O6 — CID 22979674
3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methyl-N-(8-oxo-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)benzamide (PubChem CID 22979674) has the molecular formula C36H21F6N3O6 and a molecular weight of 705.57 g/mol. Its IUPAC name is 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methyl-N-(8-oxo-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)benzamide.
| Compound Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methyl-N-(8-oxo-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)benzamide |
|---|---|
| PubChem CID | 22979674 |
| Molecular Formula | C36H21F6N3O6 |
| Molecular Weight | 705.57 g/mol |
| Exact Mass | 705.13 |
| IUPAC Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methyl-N-(8-oxo-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)C(=O)C3)cc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C36H21F6N3O6/c1-16-9-18(29(47)43-21-6-3-17-12-28(46)25(17)15-21)11-22(10-16)45-32(50)24-8-5-20(14-27(24)33(45)51)34(35(37,38)39,36(40,41)42)19-4-7-23-26(13-19)31(49)44(2)30(23)48/h3-11,13-15H,12H2,1-2H3,(H,43,47) |
| InChIKey | RPFPSLOADUYXPW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|