C23H32O7 — CID 22982300
methyl 2-methyl-2-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-3-(4-methyl-2-oxooxan-3-yl)propanoate (PubChem CID 22982300) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is methyl 2-methyl-2-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-3-(4-methyl-2-oxooxan-3-yl)propanoate.
| Compound Name | methyl 2-methyl-2-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-3-(4-methyl-2-oxooxan-3-yl)propanoate |
|---|---|
| PubChem CID | 22982300 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | methyl 2-methyl-2-[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]-3-(4-methyl-2-oxooxan-3-yl)propanoate |
| SMILES | COC(=O)C(C)(CC1C(=O)OCCC1C)C1C(=O)OC(=O)C1C1C2CCC(C2)C1C |
| InChI | InChI=1S/C23H32O7/c1-11-7-8-29-19(24)15(11)10-23(3,22(27)28-4)18-17(20(25)30-21(18)26)16-12(2)13-5-6-14(16)9-13/h11-18H,5-10H2,1-4H3 |
| InChIKey | GBOATFFHMCMYGE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|