C25H33FO4 — CID 22983939
2-fluoro-17-(4-hydroxybut-1-ynyl)-3-(2-methoxyethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 22983939) has the molecular formula C25H33FO4 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-fluoro-17-(4-hydroxybut-1-ynyl)-3-(2-methoxyethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 2-fluoro-17-(4-hydroxybut-1-ynyl)-3-(2-methoxyethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22983939 |
| Molecular Formula | C25H33FO4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-fluoro-17-(4-hydroxybut-1-ynyl)-3-(2-methoxyethoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COCCOc1cc2c(cc1F)C1CCC3(C)C(CCC3(O)C#CCCO)C1CC2 |
| InChI | InChI=1S/C25H33FO4/c1-24-10-7-18-19(21(24)8-11-25(24,28)9-3-4-12-27)6-5-17-15-23(30-14-13-29-2)22(26)16-20(17)18/h15-16,18-19,21,27-28H,4-8,10-14H2,1-2H3 |
| InChIKey | HAOZTIGFZCOELS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|