C24H32O2 — CID 59185238
(8R,9S,13S,14S,17S)-17-(5-hydroxypent-1-ynyl)-3,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 59185238) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-(5-hydroxypent-1-ynyl)-3,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-17-(5-hydroxypent-1-ynyl)-3,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59185238 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-(5-hydroxypent-1-ynyl)-3,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C#CCCCO |
| InChI | InChI=1S/C24H32O2/c1-17-6-8-19-18(16-17)7-9-21-20(19)10-13-23(2)22(21)11-14-24(23,26)12-4-3-5-15-25/h6,8,16,20-22,25-26H,3,5,7,9-11,13-15H2,1-2H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | DZUZTVXOMPORKE-DJCPXJLLSA-N |
| XLogP | 4.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|