C27H35FO3 — CID 59048343
(13S,17S)-3-fluoro-13-methyl-17-[4-(oxan-2-yloxy)but-1-ynyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 59048343) has the molecular formula C27H35FO3 and a molecular weight of 426.57 g/mol. Its IUPAC name is (13S,17S)-3-fluoro-13-methyl-17-[4-(oxan-2-yloxy)but-1-ynyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,17S)-3-fluoro-13-methyl-17-[4-(oxan-2-yloxy)but-1-ynyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59048343 |
| Molecular Formula | C27H35FO3 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (13S,17S)-3-fluoro-13-methyl-17-[4-(oxan-2-yloxy)but-1-ynyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCC3c4ccc(F)cc4CCC3C1CC[C@@]2(O)C#CCCOC1CCCCO1 |
| InChI | InChI=1S/C27H35FO3/c1-26-14-11-22-21-10-8-20(28)18-19(21)7-9-23(22)24(26)12-15-27(26,29)13-3-5-17-31-25-6-2-4-16-30-25/h8,10,18,22-25,29H,2,4-7,9,11-12,14-17H2,1H3/t22?,23?,24?,25?,26-,27-/m0/s1 |
| InChIKey | MANLJNUQIWKYCQ-YBVVDDHGSA-N |
| XLogP | 5.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|