C19H20O3S2 — CID 22985977
methyl 4-(4-phenoxyphenyl)sulfanylthiane-4-carboxylate (PubChem CID 22985977) has the molecular formula C19H20O3S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is methyl 4-(4-phenoxyphenyl)sulfanylthiane-4-carboxylate.
| Compound Name | methyl 4-(4-phenoxyphenyl)sulfanylthiane-4-carboxylate |
|---|---|
| PubChem CID | 22985977 |
| Molecular Formula | C19H20O3S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 4-(4-phenoxyphenyl)sulfanylthiane-4-carboxylate |
| SMILES | COC(=O)C1(Sc2ccc(Oc3ccccc3)cc2)CCSCC1 |
| InChI | InChI=1S/C19H20O3S2/c1-21-18(20)19(11-13-23-14-12-19)24-17-9-7-16(8-10-17)22-15-5-3-2-4-6-15/h2-10H,11-14H2,1H3 |
| InChIKey | QXJBXTYESQVSDU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |