C29H32BN3O6S — CID 22986232
CID 22986232 (PubChem CID 22986232) has the molecular formula C29H32BN3O6S and a molecular weight of 561.47 g/mol.
| Compound Name | CID 22986232 |
|---|---|
| PubChem CID | 22986232 |
| Molecular Formula | C29H32BN3O6S |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | — |
| SMILES | [B]SOc1ccc(NCc2ccc(C(=O)OC)c(OC)c2)c(NC(=O)c2ccc(OCCN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C29H32BN3O6S/c1-36-27-17-20(5-11-24(27)29(35)37-2)19-31-25-12-10-23(39-40-30)18-26(25)32-28(34)21-6-8-22(9-7-21)38-16-15-33-13-3-4-14-33/h5-12,17-18,31H,3-4,13-16,19H2,1-2H3,(H,32,34) |
| InChIKey | FYQOULFQPOXADT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|