C23H27NO4S — CID 22988206
3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydroindol-1-yl]propanethioic S-acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (PubChem CID 22988206) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydroindol-1-yl]propanethioic S-acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydroindol-1-yl]propanethioic S-acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
|---|---|
| PubChem CID | 22988206 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydroindol-1-yl]propanethioic S-acid;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| SMILES | CC(C)(C)OC(=O)C1Cc2ccccc2N1CCC(=O)S.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C16H21NO3S.C7H6O/c1-16(2,3)20-15(19)13-10-11-6-4-5-7-12(11)17(13)9-8-14(18)21;1-2-6-4-7(3-1)8-5-6/h4-7,13H,8-10H2,1-3H3,(H,18,21);1-4H,5H2 |
| InChIKey | FEGZMRFKIWLNLW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|