C29H36N6OS — CID 22989363
6-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethylsulfanyl]-7-propan-2-yl-[1,2,4]triazolo[1,5-b]pyridazine (PubChem CID 22989363) has the molecular formula C29H36N6OS and a molecular weight of 516.72 g/mol. Its IUPAC name is 6-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethylsulfanyl]-7-propan-2-yl-[1,2,4]triazolo[1,5-b]pyridazine.
| Compound Name | 6-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethylsulfanyl]-7-propan-2-yl-[1,2,4]triazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 22989363 |
| Molecular Formula | C29H36N6OS |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 6-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethylsulfanyl]-7-propan-2-yl-[1,2,4]triazolo[1,5-b]pyridazine |
| SMILES | CC(C)c1cc2ncnn2nc1SCCOCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H36N6OS/c1-23(2)26-21-27-30-22-31-35(27)32-29(26)37-20-19-36-18-17-33-13-15-34(16-14-33)28(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-12,21-23,28H,13-20H2,1-2H3 |
| InChIKey | AVFHDAGAYKLWOG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|