About 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine
3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 22989741) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| PubChem CID | 22989741 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc(COc2cncc(OCCCN(C)C)c2)cc1OC |
| InChI | InChI=1S/C19H26N2O4/c1-21(2)8-5-9-24-16-11-17(13-20-12-16)25-14-15-6-7-18(22-3)19(10-15)23-4/h6-7,10-13H,5,8-9,14H2,1-4H3 |
| InChIKey | ROWAOZYDSRYLAA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (CID 22989741) is 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine is COc1ccc(COc2cncc(OCCCN(C)C)c2)cc1OC.
What is the InChIKey of 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine?
The InChIKey is ROWAOZYDSRYLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-21(2)8-5-9-24-16-11-17(13-20-12-16)25-14-15-6-7-18(22-3)19(10-15)23-4/h6-7,10-13H,5,8-9,14H2,1-4H3.
What are the key properties of 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine?
3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine has a molecular weight of 346.43 g/mol, XLogP of 3.01, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 22989741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).