C19H26N2O4 — CID 22989741
3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 22989741) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 22989741 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[[5-[(3,4-dimethoxyphenyl)methoxy]-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc(COc2cncc(OCCCN(C)C)c2)cc1OC |
| InChI | InChI=1S/C19H26N2O4/c1-21(2)8-5-9-24-16-11-17(13-20-12-16)25-14-15-6-7-18(22-3)19(10-15)23-4/h6-7,10-13H,5,8-9,14H2,1-4H3 |
| InChIKey | ROWAOZYDSRYLAA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|