C25H30O8S — CID 22990043
methyl 7-[3-ethoxy-4-(2-propoxyethoxy)phenoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate (PubChem CID 22990043) has the molecular formula C25H30O8S and a molecular weight of 490.57 g/mol. Its IUPAC name is methyl 7-[3-ethoxy-4-(2-propoxyethoxy)phenoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate.
| Compound Name | methyl 7-[3-ethoxy-4-(2-propoxyethoxy)phenoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
|---|---|
| PubChem CID | 22990043 |
| Molecular Formula | C25H30O8S |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | methyl 7-[3-ethoxy-4-(2-propoxyethoxy)phenoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
| SMILES | CCCOCCOc1ccc(Oc2ccc3c(c2)C=C(C(=O)OC)CCS3(=O)=O)cc1OCC |
| InChI | InChI=1S/C25H30O8S/c1-4-11-30-12-13-32-22-8-6-21(17-23(22)31-5-2)33-20-7-9-24-19(16-20)15-18(25(26)29-3)10-14-34(24,27)28/h6-9,15-17H,4-5,10-14H2,1-3H3 |
| InChIKey | WPQLGGGJLIDNKO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|