C22H26O2 — CID 22990227
2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid (PubChem CID 22990227) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid.
| Compound Name | 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 22990227 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccccc1C(=O)O)c1ccc(C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C22H26O2/c1-14(2)19-11-10-17(13-21(19)15(3)4)16(5)12-18-8-6-7-9-20(18)22(23)24/h6-15H,1-5H3,(H,23,24)/b16-12+ |
| InChIKey | OTMUJTPJYDWWTA-FOWTUZBSSA-N |
| XLogP | 6.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|