2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid

C22H26O2 — CID 22990227

IUPAC2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid
SMILESC/C(=C\c1ccccc1C(=O)O)c1ccc(C(C)C)c(C(C)C)c1
InChIInChI=1S/C22H26O2/c1-14(2)19-11-10-17(13-21(19)15(3)4)16(5)12-18-8-6-7-9-20(18)22(23)24/h6-15H,1-5H3,(H,23,24)/b16-12+
InChIKeyOTMUJTPJYDWWTA-FOWTUZBSSA-N
MW322.45 g/mol
LogP6.19
Rot. Bonds5

About 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid

2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid (PubChem CID 22990227) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid.

Molecular Properties

Compound Name2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid
PubChem CID22990227
Molecular FormulaC22H26O2
Molecular Weight322.45 g/mol
Exact Mass322.19
IUPAC Name2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid
SMILESC/C(=C\c1ccccc1C(=O)O)c1ccc(C(C)C)c(C(C)C)c1
InChIInChI=1S/C22H26O2/c1-14(2)19-11-10-17(13-21(19)15(3)4)16(5)12-18-8-6-7-9-20(18)22(23)24/h6-15H,1-5H3,(H,23,24)/b16-12+
InChIKeyOTMUJTPJYDWWTA-FOWTUZBSSA-N
XLogP6.19
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500322.45
LogP ≤ 56.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid?
The IUPAC name of 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid (CID 22990227) is 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid.
What is the SMILES notation for 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid?
The canonical SMILES for 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid is C/C(=C\c1ccccc1C(=O)O)c1ccc(C(C)C)c(C(C)C)c1.
What is the InChIKey of 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid?
The InChIKey is OTMUJTPJYDWWTA-FOWTUZBSSA-N. The full InChI is InChI=1S/C22H26O2/c1-14(2)19-11-10-17(13-21(19)15(3)4)16(5)12-18-8-6-7-9-20(18)22(23)24/h6-15H,1-5H3,(H,23,24)/b16-12+.
What are the key properties of 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid?
2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid has a molecular weight of 322.45 g/mol, XLogP of 6.19, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[3,4-di(propan-2-yl)phenyl]prop-1-enyl]benzoic acid is sourced from PubChem (CID 22990227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).