C17H22O4 — CID 22992618
[prop-2-enoyloxy(1-tricyclo[5.2.1.02,6]decanyl)methyl] prop-2-enoate (PubChem CID 22992618) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [prop-2-enoyloxy(1-tricyclo[5.2.1.02,6]decanyl)methyl] prop-2-enoate.
| Compound Name | [prop-2-enoyloxy(1-tricyclo[5.2.1.02,6]decanyl)methyl] prop-2-enoate |
|---|---|
| PubChem CID | 22992618 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [prop-2-enoyloxy(1-tricyclo[5.2.1.02,6]decanyl)methyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OC(=O)C=C)C12CCC(C1)C1CCCC12 |
| InChI | InChI=1S/C17H22O4/c1-3-14(18)20-16(21-15(19)4-2)17-9-8-11(10-17)12-6-5-7-13(12)17/h3-4,11-13,16H,1-2,5-10H2 |
| InChIKey | HCGAAWGYMYIRPL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|