C26H33Cl3N4O2 — CID 22999479
N-(6-aminohexyl)-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-2H-imidazol-1-yl]acetamide (PubChem CID 22999479) has the molecular formula C26H33Cl3N4O2 and a molecular weight of 539.94 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-2H-imidazol-1-yl]acetamide.
| Compound Name | N-(6-aminohexyl)-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-2H-imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 22999479 |
| Molecular Formula | C26H33Cl3N4O2 |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-(6-aminohexyl)-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-2H-imidazol-1-yl]acetamide |
| SMILES | NCCCCCCNC(=O)CN1C=CN(CC(OCc2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C26H33Cl3N4O2/c27-21-7-5-20(6-8-21)18-35-25(23-10-9-22(28)15-24(23)29)16-32-13-14-33(19-32)17-26(34)31-12-4-2-1-3-11-30/h5-10,13-15,25H,1-4,11-12,16-19,30H2,(H,31,34) |
| InChIKey | GHGCFJGBPOQLPE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|