C15H14F3NO7S — CID 23001383
4-[2-amino-3-(furan-2-yl)-3-oxopropyl]benzenesulfonic acid;2,2,2-trifluoroacetic acid (PubChem CID 23001383) has the molecular formula C15H14F3NO7S and a molecular weight of 409.34 g/mol. Its IUPAC name is 4-[2-amino-3-(furan-2-yl)-3-oxopropyl]benzenesulfonic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-amino-3-(furan-2-yl)-3-oxopropyl]benzenesulfonic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23001383 |
| Molecular Formula | C15H14F3NO7S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-[2-amino-3-(furan-2-yl)-3-oxopropyl]benzenesulfonic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(Cc1ccc(S(=O)(=O)O)cc1)C(=O)c1ccco1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13NO5S.C2HF3O2/c14-11(13(15)12-2-1-7-19-12)8-9-3-5-10(6-4-9)20(16,17)18;3-2(4,5)1(6)7/h1-7,11H,8,14H2,(H,16,17,18);(H,6,7) |
| InChIKey | FLHRDMRVOBSMNN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|