C18H19N5O6 — CID 23004085
5-acetyl-2-(2-azidoethoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 23004085) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is 5-acetyl-2-(2-azidoethoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 5-acetyl-2-(2-azidoethoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 23004085 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 5-acetyl-2-(2-azidoethoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CC(=O)C1=C(C)N(c2ccc([N+](=O)[O-])cc2)C(COCCN=[N+]=[N-])=C(C(=O)O)C1 |
| InChI | InChI=1S/C18H19N5O6/c1-11-15(12(2)24)9-16(18(25)26)17(10-29-8-7-20-21-19)22(11)13-3-5-14(6-4-13)23(27)28/h3-6H,7-10H2,1-2H3,(H,25,26) |
| InChIKey | NKJCNBDELCTMNI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|