C22H24N6O6 — CID 23004063
2-cyanoethyl 5-acetyl-2-(3-azidopropoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylate (PubChem CID 23004063) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-cyanoethyl 5-acetyl-2-(3-azidopropoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 5-acetyl-2-(3-azidopropoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23004063 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-cyanoethyl 5-acetyl-2-(3-azidopropoxymethyl)-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylate |
| SMILES | CC(=O)C1=C(C)N(c2ccc([N+](=O)[O-])cc2)C(COCCCN=[N+]=[N-])=C(C(=O)OCCC#N)C1 |
| InChI | InChI=1S/C22H24N6O6/c1-15-19(16(2)29)13-20(22(30)34-12-3-9-23)21(14-33-11-4-10-25-26-24)27(15)17-5-7-18(8-6-17)28(31)32/h5-8H,3-4,10-14H2,1-2H3 |
| InChIKey | NRAHNUPDLAFDRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 171.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|