C20H21N3O6 — CID 23004106
5-(2-cyanoethoxycarbonyl)-2,6-diethyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 23004106) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 5-(2-cyanoethoxycarbonyl)-2,6-diethyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 5-(2-cyanoethoxycarbonyl)-2,6-diethyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 23004106 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 5-(2-cyanoethoxycarbonyl)-2,6-diethyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCC1=C(C(=O)O)CC(C(=O)OCCC#N)=C(CC)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O6/c1-3-17-15(19(24)25)12-16(20(26)29-11-5-10-21)18(4-2)22(17)13-6-8-14(9-7-13)23(27)28/h6-9H,3-5,11-12H2,1-2H3,(H,24,25) |
| InChIKey | GEWQSRSATSMPJK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|