C24H33N5O7Si — CID 23004081
6-(3-azidopropoxymethyl)-2-ethyl-1-(4-nitrophenyl)-5-(2-trimethylsilylethoxycarbonyl)-4H-pyridine-3-carboxylic acid (PubChem CID 23004081) has the molecular formula C24H33N5O7Si and a molecular weight of 531.64 g/mol. Its IUPAC name is 6-(3-azidopropoxymethyl)-2-ethyl-1-(4-nitrophenyl)-5-(2-trimethylsilylethoxycarbonyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 6-(3-azidopropoxymethyl)-2-ethyl-1-(4-nitrophenyl)-5-(2-trimethylsilylethoxycarbonyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 23004081 |
| Molecular Formula | C24H33N5O7Si |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 6-(3-azidopropoxymethyl)-2-ethyl-1-(4-nitrophenyl)-5-(2-trimethylsilylethoxycarbonyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCC1=C(C(=O)O)CC(C(=O)OCC[Si](C)(C)C)=C(COCCCN=[N+]=[N-])N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H33N5O7Si/c1-5-21-19(23(30)31)15-20(24(32)36-13-14-37(2,3)4)22(16-35-12-6-11-26-27-25)28(21)17-7-9-18(10-8-17)29(33)34/h7-10H,5-6,11-16H2,1-4H3,(H,30,31) |
| InChIKey | MTMBYTKEMCVGLJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|