C22H27N5O7 — CID 23004153
6-(2-azidoethoxymethyl)-2-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 23004153) has the molecular formula C22H27N5O7 and a molecular weight of 473.49 g/mol. Its IUPAC name is 6-(2-azidoethoxymethyl)-2-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 6-(2-azidoethoxymethyl)-2-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 23004153 |
| Molecular Formula | C22H27N5O7 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 6-(2-azidoethoxymethyl)-2-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCC1=C(C(=O)O)CC(C(=O)OC(C)(C)C)=C(COCCN=[N+]=[N-])N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H27N5O7/c1-5-18-16(20(28)29)12-17(21(30)34-22(2,3)4)19(13-33-11-10-24-25-23)26(18)14-6-8-15(9-7-14)27(31)32/h6-9H,5,10-13H2,1-4H3,(H,28,29) |
| InChIKey | KVPQOGVGCXFTCX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|