C10H13NO2 — CID 23008907
6-methoxy-1,2,3,4-tetrahydroquinolin-4-ol (PubChem CID 23008907) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydroquinolin-4-ol.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydroquinolin-4-ol |
|---|---|
| PubChem CID | 23008907 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydroquinolin-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CCN2 |
| InChI | InChI=1S/C10H13NO2/c1-13-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-3,6,10-12H,4-5H2,1H3 |
| InChIKey | HDKOHPPRCQYVJA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|