C17H16Cl2O3 — CID 23013103
(3,5-dichloro-4-methylphenyl) 2-propan-2-yloxybenzoate (PubChem CID 23013103) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is (3,5-dichloro-4-methylphenyl) 2-propan-2-yloxybenzoate.
| Compound Name | (3,5-dichloro-4-methylphenyl) 2-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 23013103 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (3,5-dichloro-4-methylphenyl) 2-propan-2-yloxybenzoate |
| SMILES | Cc1c(Cl)cc(OC(=O)c2ccccc2OC(C)C)cc1Cl |
| InChI | InChI=1S/C17H16Cl2O3/c1-10(2)21-16-7-5-4-6-13(16)17(20)22-12-8-14(18)11(3)15(19)9-12/h4-10H,1-3H3 |
| InChIKey | ASPSIOASTBKMBN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|