C24H23N3 — CID 23015221
N-[(E)-[2-[2-(dimethylamino)cyclopenta-1,3-dien-1-yl]naphthalen-1-yl]methylideneamino]aniline (PubChem CID 23015221) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[(E)-[2-[2-(dimethylamino)cyclopenta-1,3-dien-1-yl]naphthalen-1-yl]methylideneamino]aniline.
| Compound Name | N-[(E)-[2-[2-(dimethylamino)cyclopenta-1,3-dien-1-yl]naphthalen-1-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 23015221 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[(E)-[2-[2-(dimethylamino)cyclopenta-1,3-dien-1-yl]naphthalen-1-yl]methylideneamino]aniline |
| SMILES | CN(C)C1=C(c2ccc3ccccc3c2/C=N/Nc2ccccc2)CC=C1 |
| InChI | InChI=1S/C24H23N3/c1-27(2)24-14-8-13-22(24)21-16-15-18-9-6-7-12-20(18)23(21)17-25-26-19-10-4-3-5-11-19/h3-12,14-17,26H,13H2,1-2H3/b25-17+ |
| InChIKey | KWEDFKXTBKSDCI-KOEQRZSOSA-N |
| XLogP | 5.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|