C22H26N2 — CID 23015478
4-[1-(butyliminomethyl)naphthalen-2-yl]-N,N-dimethylcyclopenta-1,4-dien-1-amine (PubChem CID 23015478) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-[1-(butyliminomethyl)naphthalen-2-yl]-N,N-dimethylcyclopenta-1,4-dien-1-amine.
| Compound Name | 4-[1-(butyliminomethyl)naphthalen-2-yl]-N,N-dimethylcyclopenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 23015478 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[1-(butyliminomethyl)naphthalen-2-yl]-N,N-dimethylcyclopenta-1,4-dien-1-amine |
| SMILES | CCCC/N=C/c1c(C2=CC(N(C)C)=CC2)ccc2ccccc12 |
| InChI | InChI=1S/C22H26N2/c1-4-5-14-23-16-22-20-9-7-6-8-17(20)11-13-21(22)18-10-12-19(15-18)24(2)3/h6-9,11-13,15-16H,4-5,10,14H2,1-3H3/b23-16+ |
| InChIKey | VDKBQEGZJFKSDP-XQNSMLJCSA-N |
| XLogP | 5.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|