C8H11NO3 — CID 23018030
4-(2-oxoethylidene)piperidine-1-carboxylic acid (PubChem CID 23018030) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(2-oxoethylidene)piperidine-1-carboxylic acid.
| Compound Name | 4-(2-oxoethylidene)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 23018030 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-(2-oxoethylidene)piperidine-1-carboxylic acid |
| SMILES | O=CC=C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C8H11NO3/c10-6-3-7-1-4-9(5-2-7)8(11)12/h3,6H,1-2,4-5H2,(H,11,12) |
| InChIKey | HLNVJNXLQFTAGM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|