C17H18F3NO2 — CID 146380545
4-[[2-cyclopropyl-4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carboxylic acid (PubChem CID 146380545) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[[2-cyclopropyl-4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carboxylic acid.
| Compound Name | 4-[[2-cyclopropyl-4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146380545 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[[2-cyclopropyl-4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(=Cc2ccc(C(F)(F)F)cc2C2CC2)CC1 |
| InChI | InChI=1S/C17H18F3NO2/c18-17(19,20)14-4-3-13(15(10-14)12-1-2-12)9-11-5-7-21(8-6-11)16(22)23/h3-4,9-10,12H,1-2,5-8H2,(H,22,23) |
| InChIKey | NIBXZVUVIYTREE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |