About butyl(2-ethylhexyl)tin(2+);methanolate
butyl(2-ethylhexyl)tin(2+);methanolate (PubChem CID 23025335) has the molecular formula C14H32O2Sn
and a molecular weight of 351.12 g/mol. Its IUPAC name is butyl(2-ethylhexyl)tin(2+);methanolate.
Molecular Properties
| Compound Name | butyl(2-ethylhexyl)tin(2+);methanolate |
| PubChem CID | 23025335 |
| Molecular Formula | C14H32O2Sn |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | butyl(2-ethylhexyl)tin(2+);methanolate |
| SMILES | CCCC[Sn+2]CC(CC)CCCC.C[O-].C[O-] |
| InChI | InChI=1S/C8H17.C4H9.2CH3O.Sn/c1-4-6-7-8(3)5-2;1-3-4-2;2*1-2;/h8H,3-7H2,1-2H3;1,3-4H2,2H3;2*1H3;/q;;2*-1;+2 |
| InChIKey | TWPGPCVVLAXPBE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(2-ethylhexyl)tin(2+);methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(2-ethylhexyl)tin(2+);methanolate?
The IUPAC name of butyl(2-ethylhexyl)tin(2+);methanolate (CID 23025335) is butyl(2-ethylhexyl)tin(2+);methanolate.
What is the SMILES notation for butyl(2-ethylhexyl)tin(2+);methanolate?
The canonical SMILES for butyl(2-ethylhexyl)tin(2+);methanolate is CCCC[Sn+2]CC(CC)CCCC.C[O-].C[O-].
What is the InChIKey of butyl(2-ethylhexyl)tin(2+);methanolate?
The InChIKey is TWPGPCVVLAXPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.C4H9.2CH3O.Sn/c1-4-6-7-8(3)5-2;1-3-4-2;2*1-2;/h8H,3-7H2,1-2H3;1,3-4H2,2H3;2*1H3;/q;;2*-1;+2.
What are the key properties of butyl(2-ethylhexyl)tin(2+);methanolate?
butyl(2-ethylhexyl)tin(2+);methanolate has a molecular weight of 351.12 g/mol, XLogP of 2.50, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(2-ethylhexyl)tin(2+);methanolate is sourced from PubChem (CID 23025335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).