C14H19NO6S — CID 23034230
propan-2-yl 2-acetamido-2-(4-methylsulfonyloxyphenyl)acetate (PubChem CID 23034230) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is propan-2-yl 2-acetamido-2-(4-methylsulfonyloxyphenyl)acetate.
| Compound Name | propan-2-yl 2-acetamido-2-(4-methylsulfonyloxyphenyl)acetate |
|---|---|
| PubChem CID | 23034230 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | propan-2-yl 2-acetamido-2-(4-methylsulfonyloxyphenyl)acetate |
| SMILES | CC(=O)NC(C(=O)OC(C)C)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-9(2)20-14(17)13(15-10(3)16)11-5-7-12(8-6-11)21-22(4,18)19/h5-9,13H,1-4H3,(H,15,16) |
| InChIKey | YHFBDUGOOXOFQU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|