C6H5Cl3O3 — CID 23038083
1,1,1-trichlorohexane-2,3,5-trione (PubChem CID 23038083) has the molecular formula C6H5Cl3O3 and a molecular weight of 231.46 g/mol. Its IUPAC name is 1,1,1-trichlorohexane-2,3,5-trione.
| Compound Name | 1,1,1-trichlorohexane-2,3,5-trione |
|---|---|
| PubChem CID | 23038083 |
| Molecular Formula | C6H5Cl3O3 |
| Molecular Weight | 231.46 g/mol |
| Exact Mass | 229.93 |
| IUPAC Name | 1,1,1-trichlorohexane-2,3,5-trione |
| SMILES | CC(=O)CC(=O)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H5Cl3O3/c1-3(10)2-4(11)5(12)6(7,8)9/h2H2,1H3 |
| InChIKey | GZQILQOWQAQMGD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|