C18H16FN3O3 — CID 2304039
(6R)-3-benzyl-6-(2-fluorophenyl)-4-methyl-5-nitro-1,6-dihydropyrimidin-2-one (PubChem CID 2304039) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is (6R)-3-benzyl-6-(2-fluorophenyl)-4-methyl-5-nitro-1,6-dihydropyrimidin-2-one.
| Compound Name | (6R)-3-benzyl-6-(2-fluorophenyl)-4-methyl-5-nitro-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 2304039 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (6R)-3-benzyl-6-(2-fluorophenyl)-4-methyl-5-nitro-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C([N+](=O)[O-])[C@@H](c2ccccc2F)NC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H16FN3O3/c1-12-17(22(24)25)16(14-9-5-6-10-15(14)19)20-18(23)21(12)11-13-7-3-2-4-8-13/h2-10,16H,11H2,1H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | BOQYVZWHKUVROY-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|