C26H30N5O3+ — CID 23041895
N-(1-benzylpiperidin-4-yl)-4-[(1-oxo-2,3-dihydroimidazo[4,5-b]quinolin-1-ium-7-yl)oxy]butanamide (PubChem CID 23041895) has the molecular formula C26H30N5O3+ and a molecular weight of 460.56 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-[(1-oxo-2,3-dihydroimidazo[4,5-b]quinolin-1-ium-7-yl)oxy]butanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-[(1-oxo-2,3-dihydroimidazo[4,5-b]quinolin-1-ium-7-yl)oxy]butanamide |
|---|---|
| PubChem CID | 23041895 |
| Molecular Formula | C26H30N5O3+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-[(1-oxo-2,3-dihydroimidazo[4,5-b]quinolin-1-ium-7-yl)oxy]butanamide |
| SMILES | O=C(CCCOc1ccc2nc3c(cc2c1)[N+](=O)CN3)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N5O3/c32-25(28-21-10-12-30(13-11-21)17-19-5-2-1-3-6-19)7-4-14-34-22-8-9-23-20(15-22)16-24-26(29-23)27-18-31(24)33/h1-3,5-6,8-9,15-16,21H,4,7,10-14,17-18H2,(H-,27,28,29,32,33)/p+1 |
| InChIKey | OUBQAMLJZZNTAQ-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|