C14H10N2 — CID 23049991
(5Z)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene (PubChem CID 23049991) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (5Z)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene.
| Compound Name | (5Z)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 23049991 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (5Z)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene |
| SMILES | C1=C2CC3=c4ccc(c1c4/C=C\C/N=C\3)=N2 |
| InChI | InChI=1S/C14H10N2/c1-2-12-11-3-4-14-13(12)7-10(16-14)6-9(11)8-15-5-1/h1-4,7-8H,5-6H2/b2-1-,15-8- |
| InChIKey | KYKVZXQKBORIQZ-WLUWQPJKSA-N |
| XLogP | 1.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |