C14H14N2O4 — CID 23051908
3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]propoxy]benzaldehyde (PubChem CID 23051908) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]propoxy]benzaldehyde.
| Compound Name | 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 23051908 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]propoxy]benzaldehyde |
| SMILES | Nc1c(NCCCOc2cccc(C=O)c2)c(=O)c1=O |
| InChI | InChI=1S/C14H14N2O4/c15-11-12(14(19)13(11)18)16-5-2-6-20-10-4-1-3-9(7-10)8-17/h1,3-4,7-8,16H,2,5-6,15H2 |
| InChIKey | CBDAHBDDJSOAQK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|