C21H29N3O3 — CID 57120449
3-amino-4-[3-[3-(heptyliminomethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 57120449) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-amino-4-[3-[3-(heptyliminomethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[3-[3-(heptyliminomethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 57120449 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-amino-4-[3-[3-(heptyliminomethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCC/N=C/c1cccc(OCCCNc2c(N)c(=O)c2=O)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-2-3-4-5-6-11-23-15-16-9-7-10-17(14-16)27-13-8-12-24-19-18(22)20(25)21(19)26/h7,9-10,14-15,24H,2-6,8,11-13,22H2,1H3/b23-15+ |
| InChIKey | TXPHYEYNYGJGSO-HZHRSRAPSA-N |
| XLogP | 3.14 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|