C8H7F7O4 — CID 2305654
(2R)-2-(2,2,3,3,4,4,4-heptafluorobutyl)butanedioic acid (PubChem CID 2305654) has the molecular formula C8H7F7O4 and a molecular weight of 300.13 g/mol. Its IUPAC name is (2R)-2-(2,2,3,3,4,4,4-heptafluorobutyl)butanedioic acid.
| Compound Name | (2R)-2-(2,2,3,3,4,4,4-heptafluorobutyl)butanedioic acid |
|---|---|
| PubChem CID | 2305654 |
| Molecular Formula | C8H7F7O4 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (2R)-2-(2,2,3,3,4,4,4-heptafluorobutyl)butanedioic acid |
| SMILES | O=C(O)CC(CC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H7F7O4/c9-6(10,7(11,12)8(13,14)15)2-3(5(18)19)1-4(16)17/h3H,1-2H2,(H,16,17)(H,18,19) |
| InChIKey | LSASNNWMPFETSE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|